C14H14BrFN2O — CID 80881519
6-(4-bromo-2-fluorophenoxy)-N-propylpyridin-2-amine (PubChem CID 80881519) has the molecular formula C14H14BrFN2O and a molecular weight of 325.18 g/mol. Its IUPAC name is 6-(4-bromo-2-fluorophenoxy)-N-propylpyridin-2-amine.
| Compound Name | 6-(4-bromo-2-fluorophenoxy)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 80881519 |
| Molecular Formula | C14H14BrFN2O |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 6-(4-bromo-2-fluorophenoxy)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cccc(Oc2ccc(Br)cc2F)n1 |
| InChI | InChI=1S/C14H14BrFN2O/c1-2-8-17-13-4-3-5-14(18-13)19-12-7-6-10(15)9-11(12)16/h3-7,9H,2,8H2,1H3,(H,17,18) |
| InChIKey | OEZXVNUEIZHBEF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |