C14H20N4S — CID 80885574
8-cyclohexylsulfanyl-N-ethylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80885574) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 8-cyclohexylsulfanyl-N-ethylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-cyclohexylsulfanyl-N-ethylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80885574 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 8-cyclohexylsulfanyl-N-ethylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCNc1cn2ccnc2c(SC2CCCCC2)n1 |
| InChI | InChI=1S/C14H20N4S/c1-2-15-12-10-18-9-8-16-13(18)14(17-12)19-11-6-4-3-5-7-11/h8-11,15H,2-7H2,1H3 |
| InChIKey | KALMGQVLVSCAFW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |