C12H16N4S — CID 80886028
8-cyclohexylsulfanylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80886028) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 8-cyclohexylsulfanylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-cyclohexylsulfanylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80886028 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 8-cyclohexylsulfanylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(SC2CCCCC2)n1 |
| InChI | InChI=1S/C12H16N4S/c13-10-8-16-7-6-14-11(16)12(15-10)17-9-4-2-1-3-5-9/h6-9H,1-5,13H2 |
| InChIKey | VHFXEHVGQYLYJS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |