About 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine
8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 107784998) has the molecular formula C9H8N6S
and a molecular weight of 232.27 g/mol. Its IUPAC name is 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine |
| PubChem CID | 107784998 |
| Molecular Formula | C9H8N6S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(Sc2ncc[nH]2)n1 |
| InChI | InChI=1S/C9H8N6S/c10-6-5-15-4-3-11-7(15)8(14-6)16-9-12-1-2-13-9/h1-5H,10H2,(H,12,13) |
| InChIKey | CXHJLDBOVHKFHL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine?
The IUPAC name of 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine (CID 107784998) is 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine.
What is the SMILES notation for 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine?
The canonical SMILES for 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine is Nc1cn2ccnc2c(Sc2ncc[nH]2)n1.
What is the InChIKey of 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine?
The InChIKey is CXHJLDBOVHKFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N6S/c10-6-5-15-4-3-11-7(15)8(14-6)16-9-12-1-2-13-9/h1-5H,10H2,(H,12,13).
What are the key properties of 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine?
8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine has a molecular weight of 232.27 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1H-imidazol-2-ylsulfanyl)imidazo[1,2-a]pyrazin-6-amine is sourced from PubChem (CID 107784998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).