C10H8N6S — CID 80889016
8-pyrazin-2-ylsulfanylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80889016) has the molecular formula C10H8N6S and a molecular weight of 244.28 g/mol. Its IUPAC name is 8-pyrazin-2-ylsulfanylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-pyrazin-2-ylsulfanylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80889016 |
| Molecular Formula | C10H8N6S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 8-pyrazin-2-ylsulfanylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(Sc2cnccn2)n1 |
| InChI | InChI=1S/C10H8N6S/c11-7-6-16-4-3-14-9(16)10(15-7)17-8-5-12-1-2-13-8/h1-6H,11H2 |
| InChIKey | WSAKKUDPYJREFU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |