C16H18N4S — CID 80872311
8-(4-tert-butylphenyl)sulfanylimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80872311) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 8-(4-tert-butylphenyl)sulfanylimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(4-tert-butylphenyl)sulfanylimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80872311 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 8-(4-tert-butylphenyl)sulfanylimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CC(C)(C)c1ccc(Sc2nc(N)cn3ccnc23)cc1 |
| InChI | InChI=1S/C16H18N4S/c1-16(2,3)11-4-6-12(7-5-11)21-15-14-18-8-9-20(14)10-13(17)19-15/h4-10H,17H2,1-3H3 |
| InChIKey | FEACUBAOGOATHN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |