C12H17N5O — CID 80827493
2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]cyclohexan-1-ol (PubChem CID 80827493) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]cyclohexan-1-ol.
| Compound Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 80827493 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]cyclohexan-1-ol |
| SMILES | Nc1cn2ccnc2c(NC2CCCCC2O)n1 |
| InChI | InChI=1S/C12H17N5O/c13-10-7-17-6-5-14-12(17)11(16-10)15-8-3-1-2-4-9(8)18/h5-9,18H,1-4,13H2,(H,15,16) |
| InChIKey | YXENPFAVWYYWPE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |