C11H12N6O2 — CID 80856508
3-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-1-methylpyrrolidine-2,5-dione (PubChem CID 80856508) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is 3-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 80856508 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)CC(Nc2nc(N)cn3ccnc23)C1=O |
| InChI | InChI=1S/C11H12N6O2/c1-16-8(18)4-6(11(16)19)14-9-10-13-2-3-17(10)5-7(12)15-9/h2-3,5-6H,4,12H2,1H3,(H,14,15) |
| InChIKey | VOVWHSXHCQTLJB-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|