About 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine
8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 130548707) has the molecular formula C9H11N5
and a molecular weight of 189.22 g/mol. Its IUPAC name is 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine.
Molecular Properties
| Compound Name | 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine |
| PubChem CID | 130548707 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(N2CCC2)n1 |
| InChI | InChI=1S/C9H11N5/c10-7-6-14-5-2-11-8(14)9(12-7)13-3-1-4-13/h2,5-6H,1,3-4,10H2 |
| InChIKey | JENHRISCHQBTQR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine?
The IUPAC name of 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine (CID 130548707) is 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine.
What is the SMILES notation for 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine?
The canonical SMILES for 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine is Nc1cn2ccnc2c(N2CCC2)n1.
What is the InChIKey of 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine?
The InChIKey is JENHRISCHQBTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5/c10-7-6-14-5-2-11-8(14)9(12-7)13-3-1-4-13/h2,5-6H,1,3-4,10H2.
What are the key properties of 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine?
8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine has a molecular weight of 189.22 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(azetidin-1-yl)imidazo[1,2-a]pyrazin-6-amine is sourced from PubChem (CID 130548707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).