C13H21N3O2S — CID 80885711
ethyl 2-[6-(ethylamino)-5-propylpyrimidin-4-yl]sulfanylacetate (PubChem CID 80885711) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is ethyl 2-[6-(ethylamino)-5-propylpyrimidin-4-yl]sulfanylacetate.
| Compound Name | ethyl 2-[6-(ethylamino)-5-propylpyrimidin-4-yl]sulfanylacetate |
|---|---|
| PubChem CID | 80885711 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | ethyl 2-[6-(ethylamino)-5-propylpyrimidin-4-yl]sulfanylacetate |
| SMILES | CCCc1c(NCC)ncnc1SCC(=O)OCC |
| InChI | InChI=1S/C13H21N3O2S/c1-4-7-10-12(14-5-2)15-9-16-13(10)19-8-11(17)18-6-3/h9H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | OHCIVJZEYXZGHL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |