C11H18N4O2S — CID 114235128
N-ethyl-2-[6-(ethylamino)-5-methoxypyrimidin-4-yl]sulfanylacetamide (PubChem CID 114235128) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is N-ethyl-2-[6-(ethylamino)-5-methoxypyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-ethyl-2-[6-(ethylamino)-5-methoxypyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 114235128 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-ethyl-2-[6-(ethylamino)-5-methoxypyrimidin-4-yl]sulfanylacetamide |
| SMILES | CCNC(=O)CSc1ncnc(NCC)c1OC |
| InChI | InChI=1S/C11H18N4O2S/c1-4-12-8(16)6-18-11-9(17-3)10(13-5-2)14-7-15-11/h7H,4-6H2,1-3H3,(H,12,16)(H,13,14,15) |
| InChIKey | SNWOZFQCLBEQIR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |