C9H10FN5S — CID 80887976
5-fluoro-N-methyl-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-amine (PubChem CID 80887976) has the molecular formula C9H10FN5S and a molecular weight of 239.28 g/mol. Its IUPAC name is 5-fluoro-N-methyl-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 5-fluoro-N-methyl-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80887976 |
| Molecular Formula | C9H10FN5S |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-fluoro-N-methyl-4-(1-methylimidazol-2-yl)sulfanylpyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(Sc2nccn2C)n1 |
| InChI | InChI=1S/C9H10FN5S/c1-11-8-13-5-6(10)7(14-8)16-9-12-3-4-15(9)2/h3-5H,1-2H3,(H,11,13,14) |
| InChIKey | BWSHTOBVKHDAQX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |