C15H19ClN4S — CID 80888443
6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propan-2-yl-N-propylpyrimidin-4-amine (PubChem CID 80888443) has the molecular formula C15H19ClN4S and a molecular weight of 322.87 g/mol. Its IUPAC name is 6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propan-2-yl-N-propylpyrimidin-4-amine.
| Compound Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propan-2-yl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80888443 |
| Molecular Formula | C15H19ClN4S |
| Molecular Weight | 322.87 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propan-2-yl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(Sc2ncccc2Cl)c1C(C)C |
| InChI | InChI=1S/C15H19ClN4S/c1-4-7-17-13-12(10(2)3)15(20-9-19-13)21-14-11(16)6-5-8-18-14/h5-6,8-10H,4,7H2,1-3H3,(H,17,19,20) |
| InChIKey | IUMDDDMBVDIUBR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |