C12H13ClN4S — CID 80891436
6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propylpyrimidin-4-amine (PubChem CID 80891436) has the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. Its IUPAC name is 6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propylpyrimidin-4-amine.
| Compound Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80891436 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 6-[(3-chloro-2-pyridinyl)sulfanyl]-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(N)ncnc1Sc1ncccc1Cl |
| InChI | InChI=1S/C12H13ClN4S/c1-2-4-8-10(14)16-7-17-11(8)18-12-9(13)5-3-6-15-12/h3,5-7H,2,4H2,1H3,(H2,14,16,17) |
| InChIKey | GYHBRDSNYLUGAF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |