C13H13Cl2N3S — CID 80891496
6-(3,4-dichlorophenyl)sulfanyl-5-propylpyrimidin-4-amine (PubChem CID 80891496) has the molecular formula C13H13Cl2N3S and a molecular weight of 314.24 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)sulfanyl-5-propylpyrimidin-4-amine.
| Compound Name | 6-(3,4-dichlorophenyl)sulfanyl-5-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80891496 |
| Molecular Formula | C13H13Cl2N3S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 6-(3,4-dichlorophenyl)sulfanyl-5-propylpyrimidin-4-amine |
| SMILES | CCCc1c(N)ncnc1Sc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3S/c1-2-3-9-12(16)17-7-18-13(9)19-8-4-5-10(14)11(15)6-8/h4-7H,2-3H2,1H3,(H2,16,17,18) |
| InChIKey | XBYPDLGSPAAEQB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |