C12H15N3S2 — CID 80888546
N-methyl-5-propan-2-yl-6-thiophen-2-ylsulfanylpyrimidin-4-amine (PubChem CID 80888546) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is N-methyl-5-propan-2-yl-6-thiophen-2-ylsulfanylpyrimidin-4-amine.
| Compound Name | N-methyl-5-propan-2-yl-6-thiophen-2-ylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80888546 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-methyl-5-propan-2-yl-6-thiophen-2-ylsulfanylpyrimidin-4-amine |
| SMILES | CNc1ncnc(Sc2cccs2)c1C(C)C |
| InChI | InChI=1S/C12H15N3S2/c1-8(2)10-11(13-3)14-7-15-12(10)17-9-5-4-6-16-9/h4-8H,1-3H3,(H,13,14,15) |
| InChIKey | RYVSYPDCLCPKLJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |