C14H17N3O2S2 — CID 80888556
N-ethyl-2-methyl-6-(4-methylsulfonylphenyl)sulfanylpyrimidin-4-amine (PubChem CID 80888556) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-ethyl-2-methyl-6-(4-methylsulfonylphenyl)sulfanylpyrimidin-4-amine.
| Compound Name | N-ethyl-2-methyl-6-(4-methylsulfonylphenyl)sulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80888556 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-ethyl-2-methyl-6-(4-methylsulfonylphenyl)sulfanylpyrimidin-4-amine |
| SMILES | CCNc1cc(Sc2ccc(S(C)(=O)=O)cc2)nc(C)n1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-4-15-13-9-14(17-10(2)16-13)20-11-5-7-12(8-6-11)21(3,18)19/h5-9H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | XCJWWGBJSURFSH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |