C12H13BrN6O2 — CID 80899819
N-[(2-bromophenyl)methyl]-6-hydrazinyl-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 80899819) has the molecular formula C12H13BrN6O2 and a molecular weight of 353.18 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-6-hydrazinyl-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | N-[(2-bromophenyl)methyl]-6-hydrazinyl-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80899819 |
| Molecular Formula | C12H13BrN6O2 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-6-hydrazinyl-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CN(Cc1ccccc1Br)c1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13BrN6O2/c1-18(6-8-4-2-3-5-9(8)13)12-10(19(20)21)11(17-14)15-7-16-12/h2-5,7H,6,14H2,1H3,(H,15,16,17) |
| InChIKey | ZSLCKNHWGHYWHB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|