C14H26N6O — CID 80900563
4-hydrazinyl-N-methyl-N-(3-methylcyclohexyl)-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 80900563) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-hydrazinyl-N-methyl-N-(3-methylcyclohexyl)-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-hydrazinyl-N-methyl-N-(3-methylcyclohexyl)-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80900563 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-hydrazinyl-N-methyl-N-(3-methylcyclohexyl)-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(NN)nc(N(C)C2CCCC(C)C2)n1 |
| InChI | InChI=1S/C14H26N6O/c1-4-8-21-14-17-12(19-15)16-13(18-14)20(3)11-7-5-6-10(2)9-11/h10-11H,4-9,15H2,1-3H3,(H,16,17,18,19) |
| InChIKey | DBFZQLKHAIVEMA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|