C13H23N5O3 — CID 80924501
[4-(3-methoxycyclohexyl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80924501) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is [4-(3-methoxycyclohexyl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(3-methoxycyclohexyl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80924501 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | [4-(3-methoxycyclohexyl)oxy-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(OC2CCCC(OC)C2)n1 |
| InChI | InChI=1S/C13H23N5O3/c1-3-7-20-12-15-11(18-14)16-13(17-12)21-10-6-4-5-9(8-10)19-2/h9-10H,3-8,14H2,1-2H3,(H,15,16,17,18) |
| InChIKey | FCPQTXSVJYWJHO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|