C14H26N6O — CID 80902394
2-[ethyl-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]-N-propan-2-ylacetamide (PubChem CID 80902394) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[ethyl-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[ethyl-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 80902394 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-[ethyl-(6-hydrazinyl-5-propan-2-ylpyrimidin-4-yl)amino]-N-propan-2-ylacetamide |
| SMILES | CCN(CC(=O)NC(C)C)c1ncnc(NN)c1C(C)C |
| InChI | InChI=1S/C14H26N6O/c1-6-20(7-11(21)18-10(4)5)14-12(9(2)3)13(19-15)16-8-17-14/h8-10H,6-7,15H2,1-5H3,(H,18,21)(H,16,17,19) |
| InChIKey | KUIPMDZWQHQODF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|