C10H13N5O — CID 80907705
N-[1-(furan-2-yl)ethyl]-6-hydrazinylpyrimidin-4-amine (PubChem CID 80907705) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-6-hydrazinylpyrimidin-4-amine.
| Compound Name | N-[1-(furan-2-yl)ethyl]-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80907705 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-6-hydrazinylpyrimidin-4-amine |
| SMILES | CC(Nc1cc(NN)ncn1)c1ccco1 |
| InChI | InChI=1S/C10H13N5O/c1-7(8-3-2-4-16-8)14-9-5-10(15-11)13-6-12-9/h2-7H,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | HDAGGWCYQPKKTD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|