C11H13N3O — CID 43535641
5-N-[1-(furan-2-yl)ethyl]pyridine-2,5-diamine (PubChem CID 43535641) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-N-[1-(furan-2-yl)ethyl]pyridine-2,5-diamine.
| Compound Name | 5-N-[1-(furan-2-yl)ethyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 43535641 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 5-N-[1-(furan-2-yl)ethyl]pyridine-2,5-diamine |
| SMILES | CC(Nc1ccc(N)nc1)c1ccco1 |
| InChI | InChI=1S/C11H13N3O/c1-8(10-3-2-6-15-10)14-9-4-5-11(12)13-7-9/h2-8,14H,1H3,(H2,12,13) |
| InChIKey | VNQHRJHFSCNYMB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |