C11H20N6 — CID 80910003
[6-(3,4-dimethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]hydrazine (PubChem CID 80910003) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is [6-(3,4-dimethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3,4-dimethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80910003 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | [6-(3,4-dimethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)cc(N2CCN(C)C(C)C2)n1 |
| InChI | InChI=1S/C11H20N6/c1-8-7-17(5-4-16(8)3)11-6-10(15-12)13-9(2)14-11/h6,8H,4-5,7,12H2,1-3H3,(H,13,14,15) |
| InChIKey | LFDKIRWWDQKAEX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|