C10H18N4O2 — CID 80911104
[6-(2-ethoxyethoxy)-2,5-dimethylpyrimidin-4-yl]hydrazine (PubChem CID 80911104) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is [6-(2-ethoxyethoxy)-2,5-dimethylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2-ethoxyethoxy)-2,5-dimethylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80911104 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | [6-(2-ethoxyethoxy)-2,5-dimethylpyrimidin-4-yl]hydrazine |
| SMILES | CCOCCOc1nc(C)nc(NN)c1C |
| InChI | InChI=1S/C10H18N4O2/c1-4-15-5-6-16-10-7(2)9(14-11)12-8(3)13-10/h4-6,11H2,1-3H3,(H,12,13,14) |
| InChIKey | JGLJVEAIJFDQJG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|