C9H9F4N5O — CID 80914047
[8-(2,2,3,3-tetrafluoropropoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine (PubChem CID 80914047) has the molecular formula C9H9F4N5O and a molecular weight of 279.20 g/mol. Its IUPAC name is [8-(2,2,3,3-tetrafluoropropoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine.
| Compound Name | [8-(2,2,3,3-tetrafluoropropoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
|---|---|
| PubChem CID | 80914047 |
| Molecular Formula | C9H9F4N5O |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | [8-(2,2,3,3-tetrafluoropropoxy)imidazo[1,2-a]pyrazin-6-yl]hydrazine |
| SMILES | NNc1cn2ccnc2c(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H9F4N5O/c10-8(11)9(12,13)4-19-7-6-15-1-2-18(6)3-5(16-7)17-14/h1-3,8,17H,4,14H2 |
| InChIKey | FMDJOXVPAKPVMF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|