C9H12FN7 — CID 80914824
5-fluoro-2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]pyrimidin-4-amine (PubChem CID 80914824) has the molecular formula C9H12FN7 and a molecular weight of 237.24 g/mol. Its IUPAC name is 5-fluoro-2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 5-fluoro-2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80914824 |
| Molecular Formula | C9H12FN7 |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 5-fluoro-2-hydrazinyl-N-[(1-methylimidazol-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cn1ccnc1CNc1nc(NN)ncc1F |
| InChI | InChI=1S/C9H12FN7/c1-17-3-2-12-7(17)5-13-8-6(10)4-14-9(15-8)16-11/h2-4H,5,11H2,1H3,(H2,13,14,15,16) |
| InChIKey | STUCNLJNGIUWJU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|