C13H13FN6 — CID 80916506
3-(N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)anilino)propanenitrile (PubChem CID 80916506) has the molecular formula C13H13FN6 and a molecular weight of 272.29 g/mol. Its IUPAC name is 3-(N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)anilino)propanenitrile.
| Compound Name | 3-(N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)anilino)propanenitrile |
|---|---|
| PubChem CID | 80916506 |
| Molecular Formula | C13H13FN6 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3-(N-(5-fluoro-2-hydrazinylpyrimidin-4-yl)anilino)propanenitrile |
| SMILES | N#CCCN(c1ccccc1)c1nc(NN)ncc1F |
| InChI | InChI=1S/C13H13FN6/c14-11-9-17-13(19-16)18-12(11)20(8-4-7-15)10-5-2-1-3-6-10/h1-3,5-6,9H,4,8,16H2,(H,17,18,19) |
| InChIKey | YLOPWAHBSOSXDK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|