C11H11F2N5 — CID 80908250
5-fluoro-N-(2-fluorophenyl)-2-hydrazinyl-N-methylpyrimidin-4-amine (PubChem CID 80908250) has the molecular formula C11H11F2N5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 5-fluoro-N-(2-fluorophenyl)-2-hydrazinyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-fluoro-N-(2-fluorophenyl)-2-hydrazinyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80908250 |
| Molecular Formula | C11H11F2N5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 5-fluoro-N-(2-fluorophenyl)-2-hydrazinyl-N-methylpyrimidin-4-amine |
| SMILES | CN(c1ccccc1F)c1nc(NN)ncc1F |
| InChI | InChI=1S/C11H11F2N5/c1-18(9-5-3-2-4-7(9)12)10-8(13)6-15-11(16-10)17-14/h2-6H,14H2,1H3,(H,15,16,17) |
| InChIKey | JFJDCZQLASNDEL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|