C11H10ClN5O3 — CID 80917047
[6-(4-chloro-2-methylphenoxy)-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 80917047) has the molecular formula C11H10ClN5O3 and a molecular weight of 295.69 g/mol. Its IUPAC name is [6-(4-chloro-2-methylphenoxy)-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | [6-(4-chloro-2-methylphenoxy)-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80917047 |
| Molecular Formula | C11H10ClN5O3 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | [6-(4-chloro-2-methylphenoxy)-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(Cl)ccc1Oc1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10ClN5O3/c1-6-4-7(12)2-3-8(6)20-11-9(17(18)19)10(16-13)14-5-15-11/h2-5H,13H2,1H3,(H,14,15,16) |
| InChIKey | YEZLOYJJPVODIH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|