C10H7Br2N5O3 — CID 80921308
[6-(2,4-dibromophenoxy)-5-nitropyrimidin-4-yl]hydrazine (PubChem CID 80921308) has the molecular formula C10H7Br2N5O3 and a molecular weight of 405.01 g/mol. Its IUPAC name is [6-(2,4-dibromophenoxy)-5-nitropyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,4-dibromophenoxy)-5-nitropyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80921308 |
| Molecular Formula | C10H7Br2N5O3 |
| Molecular Weight | 405.01 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | [6-(2,4-dibromophenoxy)-5-nitropyrimidin-4-yl]hydrazine |
| SMILES | NNc1ncnc(Oc2ccc(Br)cc2Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7Br2N5O3/c11-5-1-2-7(6(12)3-5)20-10-8(17(18)19)9(16-13)14-4-15-10/h1-4H,13H2,(H,14,15,16) |
| InChIKey | MRSQZAYZBVDWNP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.01 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|