C11H16N6S — CID 80917854
2-hydrazinyl-5-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine (PubChem CID 80917854) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is 2-hydrazinyl-5-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-5-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80917854 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-hydrazinyl-5-methyl-N-[1-(4-methyl-1,3-thiazol-2-yl)ethyl]pyrimidin-4-amine |
| SMILES | Cc1csc(C(C)Nc2nc(NN)ncc2C)n1 |
| InChI | InChI=1S/C11H16N6S/c1-6-4-13-11(17-12)16-9(6)15-8(3)10-14-7(2)5-18-10/h4-5,8H,12H2,1-3H3,(H2,13,15,16,17) |
| InChIKey | DERNDCKWLWGBDF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|