C11H12N6S — CID 39782171
N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine (PubChem CID 39782171) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine.
| Compound Name | N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 39782171 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | N-[(1S)-1-(4-methyl-1,3-thiazol-2-yl)ethyl]-7H-purin-6-amine |
| SMILES | Cc1csc([C@H](C)Nc2ncnc3nc[nH]c23)n1 |
| InChI | InChI=1S/C11H12N6S/c1-6-3-18-11(16-6)7(2)17-10-8-9(13-4-12-8)14-5-15-10/h3-5,7H,1-2H3,(H2,12,13,14,15,17)/t7-/m0/s1 |
| InChIKey | IFVYPQIMHOTRPS-ZETCQYMHSA-N |
| XLogP | 2.29 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |