C11H15N7 — CID 80919004
2-hydrazinyl-6-methyl-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine (PubChem CID 80919004) has the molecular formula C11H15N7 and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-hydrazinyl-6-methyl-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-6-methyl-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80919004 |
| Molecular Formula | C11H15N7 |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-hydrazinyl-6-methyl-N-[(5-methylpyrazin-2-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1cnc(CNc2cc(C)nc(NN)n2)cn1 |
| InChI | InChI=1S/C11H15N7/c1-7-3-10(17-11(16-7)18-12)15-6-9-5-13-8(2)4-14-9/h3-5H,6,12H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | CZVQRSLXYANKQL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|