C8H9FN6S — CID 80922730
[5-fluoro-4-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-yl]hydrazine (PubChem CID 80922730) has the molecular formula C8H9FN6S and a molecular weight of 240.27 g/mol. Its IUPAC name is [5-fluoro-4-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-yl]hydrazine.
| Compound Name | [5-fluoro-4-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922730 |
| Molecular Formula | C8H9FN6S |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | [5-fluoro-4-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-yl]hydrazine |
| SMILES | Cn1cc(Sc2nc(NN)ncc2F)cn1 |
| InChI | InChI=1S/C8H9FN6S/c1-15-4-5(2-12-15)16-7-6(9)3-11-8(13-7)14-10/h2-4H,10H2,1H3,(H,11,13,14) |
| InChIKey | PRFCKUPMTYKACV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|