C11H16N8S — CID 80923227
2-(6-hydrazinyl-5-propylpyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine (PubChem CID 80923227) has the molecular formula C11H16N8S and a molecular weight of 292.37 g/mol. Its IUPAC name is 2-(6-hydrazinyl-5-propylpyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-(6-hydrazinyl-5-propylpyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80923227 |
| Molecular Formula | C11H16N8S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(6-hydrazinyl-5-propylpyrimidin-4-yl)sulfanylpyrimidine-4,6-diamine |
| SMILES | CCCc1c(NN)ncnc1Sc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C11H16N8S/c1-2-3-6-9(19-14)15-5-16-10(6)20-11-17-7(12)4-8(13)18-11/h4-5H,2-3,14H2,1H3,(H,15,16,19)(H4,12,13,17,18) |
| InChIKey | MANUUKFTFNEFJE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|