C10H14N6OS — CID 80923681
[6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 80923681) has the molecular formula C10H14N6OS and a molecular weight of 266.33 g/mol. Its IUPAC name is [6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80923681 |
| Molecular Formula | C10H14N6OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [6-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1nnc(Sc2ncnc(NN)c2C(C)C)o1 |
| InChI | InChI=1S/C10H14N6OS/c1-5(2)7-8(14-11)12-4-13-9(7)18-10-16-15-6(3)17-10/h4-5H,11H2,1-3H3,(H,12,13,14) |
| InChIKey | AVJQXZSLCHJDFR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|