C15H20N4S — CID 80931234
[6-(3,4-dimethylphenyl)sulfanyl-5-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 80931234) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is [6-(3,4-dimethylphenyl)sulfanyl-5-propan-2-ylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(3,4-dimethylphenyl)sulfanyl-5-propan-2-ylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80931234 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [6-(3,4-dimethylphenyl)sulfanyl-5-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1ccc(Sc2ncnc(NN)c2C(C)C)cc1C |
| InChI | InChI=1S/C15H20N4S/c1-9(2)13-14(19-16)17-8-18-15(13)20-12-6-5-10(3)11(4)7-12/h5-9H,16H2,1-4H3,(H,17,18,19) |
| InChIKey | QNYYEGNVPLVIKH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|