C11H21N5OS — CID 80923771
1-[ethyl-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-2-methylpropan-2-ol (PubChem CID 80923771) has the molecular formula C11H21N5OS and a molecular weight of 271.39 g/mol. Its IUPAC name is 1-[ethyl-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-[ethyl-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 80923771 |
| Molecular Formula | C11H21N5OS |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-[ethyl-(6-hydrazinyl-2-methylsulfanylpyrimidin-4-yl)amino]-2-methylpropan-2-ol |
| SMILES | CCN(CC(C)(C)O)c1cc(NN)nc(SC)n1 |
| InChI | InChI=1S/C11H21N5OS/c1-5-16(7-11(2,3)17)9-6-8(15-12)13-10(14-9)18-4/h6,17H,5,7,12H2,1-4H3,(H,13,14,15) |
| InChIKey | RKTLNFSAJIPYAF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|