C12H20N4O — CID 80928543
2-[1-(6-hydrazinyl-2-pyridinyl)piperidin-2-yl]ethanol (PubChem CID 80928543) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-[1-(6-hydrazinyl-2-pyridinyl)piperidin-2-yl]ethanol.
| Compound Name | 2-[1-(6-hydrazinyl-2-pyridinyl)piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 80928543 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 2-[1-(6-hydrazinyl-2-pyridinyl)piperidin-2-yl]ethanol |
| SMILES | NNc1cccc(N2CCCCC2CCO)n1 |
| InChI | InChI=1S/C12H20N4O/c13-15-11-5-3-6-12(14-11)16-8-2-1-4-10(16)7-9-17/h3,5-6,10,17H,1-2,4,7-9,13H2,(H,14,15) |
| InChIKey | CCTQYTFUDJDGCN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|