C9H13FN4O2 — CID 80930643
[5-fluoro-4-(oxolan-3-ylmethoxy)pyrimidin-2-yl]hydrazine (PubChem CID 80930643) has the molecular formula C9H13FN4O2 and a molecular weight of 228.23 g/mol. Its IUPAC name is [5-fluoro-4-(oxolan-3-ylmethoxy)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-fluoro-4-(oxolan-3-ylmethoxy)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80930643 |
| Molecular Formula | C9H13FN4O2 |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [5-fluoro-4-(oxolan-3-ylmethoxy)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(F)c(OCC2CCOC2)n1 |
| InChI | InChI=1S/C9H13FN4O2/c10-7-3-12-9(14-11)13-8(7)16-5-6-1-2-15-4-6/h3,6H,1-2,4-5,11H2,(H,12,13,14) |
| InChIKey | PAOUJQDEFHNMSH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|