C15H24ClN3 — CID 80936627
4-chloro-6-(4,4-diethylpiperidin-1-yl)-2-ethylpyrimidine (PubChem CID 80936627) has the molecular formula C15H24ClN3 and a molecular weight of 281.83 g/mol. Its IUPAC name is 4-chloro-6-(4,4-diethylpiperidin-1-yl)-2-ethylpyrimidine.
| Compound Name | 4-chloro-6-(4,4-diethylpiperidin-1-yl)-2-ethylpyrimidine |
|---|---|
| PubChem CID | 80936627 |
| Molecular Formula | C15H24ClN3 |
| Molecular Weight | 281.83 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 4-chloro-6-(4,4-diethylpiperidin-1-yl)-2-ethylpyrimidine |
| SMILES | CCc1nc(Cl)cc(N2CCC(CC)(CC)CC2)n1 |
| InChI | InChI=1S/C15H24ClN3/c1-4-13-17-12(16)11-14(18-13)19-9-7-15(5-2,6-3)8-10-19/h11H,4-10H2,1-3H3 |
| InChIKey | UJQQDRKBWSFIGJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.83 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |