C15H26ClN3 — CID 80939424
6-chloro-N,N-bis(2-methylpropyl)-2-propylpyrimidin-4-amine (PubChem CID 80939424) has the molecular formula C15H26ClN3 and a molecular weight of 283.85 g/mol. Its IUPAC name is 6-chloro-N,N-bis(2-methylpropyl)-2-propylpyrimidin-4-amine.
| Compound Name | 6-chloro-N,N-bis(2-methylpropyl)-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80939424 |
| Molecular Formula | C15H26ClN3 |
| Molecular Weight | 283.85 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 6-chloro-N,N-bis(2-methylpropyl)-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(Cl)cc(N(CC(C)C)CC(C)C)n1 |
| InChI | InChI=1S/C15H26ClN3/c1-6-7-14-17-13(16)8-15(18-14)19(9-11(2)3)10-12(4)5/h8,11-12H,6-7,9-10H2,1-5H3 |
| InChIKey | JVBQSQMUTFWZNK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |