C12H13N7S — CID 80940852
[2-ethyl-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-yl]hydrazine (PubChem CID 80940852) has the molecular formula C12H13N7S and a molecular weight of 287.35 g/mol. Its IUPAC name is [2-ethyl-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-ethyl-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80940852 |
| Molecular Formula | C12H13N7S |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [2-ethyl-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-yl]hydrazine |
| SMILES | CCc1nc(NN)cc(Sc2nnc3ccccn23)n1 |
| InChI | InChI=1S/C12H13N7S/c1-2-8-14-9(16-13)7-11(15-8)20-12-18-17-10-5-3-4-6-19(10)12/h3-7H,2,13H2,1H3,(H,14,15,16) |
| InChIKey | IRGYYLQMOVBMPI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|