C18H17N5S2 — CID 1039342
2-ethyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 1039342) has the molecular formula C18H17N5S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-ethyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 2-ethyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 1039342 |
| Molecular Formula | C18H17N5S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-ethyl-4-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | CCc1nc(Sc2nnc3ccccn23)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C18H17N5S2/c1-2-13-19-16-15(11-7-3-4-8-12(11)24-16)17(20-13)25-18-22-21-14-9-5-6-10-23(14)18/h5-6,9-10H,2-4,7-8H2,1H3 |
| InChIKey | IXPOVZQJBUNKGT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |