C24H24N6OS2 — CID 46808443
3-[4-methyl-5-[[2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,2,4-triazol-3-yl]propanamide (PubChem CID 46808443) has the molecular formula C24H24N6OS2 and a molecular weight of 476.63 g/mol. Its IUPAC name is 3-[4-methyl-5-[[2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[4-methyl-5-[[2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 46808443 |
| Molecular Formula | C24H24N6OS2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 3-[4-methyl-5-[[2-[(E)-2-phenylethenyl]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]-1,2,4-triazol-3-yl]propanamide |
| SMILES | Cn1c(CCC(N)=O)nnc1Sc1nc(/C=C/c2ccccc2)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C24H24N6OS2/c1-30-20(14-12-18(25)31)28-29-24(30)33-23-21-16-9-5-6-10-17(16)32-22(21)26-19(27-23)13-11-15-7-3-2-4-8-15/h2-4,7-8,11,13H,5-6,9-10,12,14H2,1H3,(H2,25,31)/b13-11+ |
| InChIKey | PBVFOYHAVUCOEU-ACCUITESSA-N |
| XLogP | 4.44 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |