C16H24N4O — CID 80941818
4-N-[2-(furan-2-yl)ethyl]-6-N,2-dipropylpyrimidine-4,6-diamine (PubChem CID 80941818) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-N-[2-(furan-2-yl)ethyl]-6-N,2-dipropylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[2-(furan-2-yl)ethyl]-6-N,2-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80941818 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 4-N-[2-(furan-2-yl)ethyl]-6-N,2-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCNc1cc(NCCc2ccco2)nc(CCC)n1 |
| InChI | InChI=1S/C16H24N4O/c1-3-6-14-19-15(17-9-4-2)12-16(20-14)18-10-8-13-7-5-11-21-13/h5,7,11-12H,3-4,6,8-10H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | QDFPYLAGRFAKIE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |