C9H11N5S — CID 80943801
6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 80943801) has the molecular formula C9H11N5S and a molecular weight of 221.29 g/mol. Its IUPAC name is 6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80943801 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(NCc2cccs2)ncn1 |
| InChI | InChI=1S/C9H11N5S/c10-14-9-4-8(12-6-13-9)11-5-7-2-1-3-15-7/h1-4,6H,5,10H2,(H2,11,12,13,14) |
| InChIKey | XUSYQJUFXABDGW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|