C12H15N5S — CID 80969142
2-cyclopropyl-6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 80969142) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-cyclopropyl-6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80969142 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-cyclopropyl-6-hydrazinyl-N-(thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | NNc1cc(NCc2cccs2)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H15N5S/c13-17-11-6-10(14-7-9-2-1-5-18-9)15-12(16-11)8-3-4-8/h1-2,5-6,8H,3-4,7,13H2,(H2,14,15,16,17) |
| InChIKey | QZRSYMAYMPUIEJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|