About 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine
4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine (PubChem CID 80945946) has the molecular formula C13H21ClN4
and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine.
Molecular Properties
| Compound Name | 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine |
| PubChem CID | 80945946 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine |
| SMILES | CCCc1nc(Cl)cc(N2CCN(C)C(C)C2)n1 |
| InChI | InChI=1S/C13H21ClN4/c1-4-5-12-15-11(14)8-13(16-12)18-7-6-17(3)10(2)9-18/h8,10H,4-7,9H2,1-3H3 |
| InChIKey | QNRVMWBTKKTXPM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine?
The IUPAC name of 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine (CID 80945946) is 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine.
What is the SMILES notation for 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine?
The canonical SMILES for 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine is CCCc1nc(Cl)cc(N2CCN(C)C(C)C2)n1.
What is the InChIKey of 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine?
The InChIKey is QNRVMWBTKKTXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN4/c1-4-5-12-15-11(14)8-13(16-12)18-7-6-17(3)10(2)9-18/h8,10H,4-7,9H2,1-3H3.
What are the key properties of 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine?
4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine has a molecular weight of 268.79 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(3,4-dimethylpiperazin-1-yl)-2-propylpyrimidine is sourced from PubChem (CID 80945946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).